C6H6FN — CID 76974055
6-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (PubChem CID 76974055) has the molecular formula C6H6FN and a molecular weight of 117.07 g/mol. Its IUPAC name is 6-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine.
| Compound Name | 6-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 76974055 |
| Molecular Formula | C6H6FN |
| Molecular Weight | 117.07 g/mol |
| Exact Mass | 117.07 |
| IUPAC Name | 6-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| SMILES | N[13c]1[13cH][13cH][13cH][13cH][13c]1F |
| InChI | InChI=1S/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | FTZQXOJYPFINKJ-IDEBNGHGSA-N |
| XLogP | 1.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.07 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|