About 2-fluoroaniline;nitrobenzene
2-fluoroaniline;nitrobenzene (PubChem CID 67592435) has the molecular formula C12H11FN2O2
and a molecular weight of 234.23 g/mol. Its IUPAC name is 2-fluoroaniline;nitrobenzene.
Molecular Properties
| Compound Name | 2-fluoroaniline;nitrobenzene |
| PubChem CID | 67592435 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-fluoroaniline;nitrobenzene |
| SMILES | Nc1ccccc1F.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H6FN.C6H5NO2/c7-5-3-1-2-4-6(5)8;8-7(9)6-4-2-1-3-5-6/h1-4H,8H2;1-5H |
| InChIKey | ZEMDOUZMHGKBFF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroaniline;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroaniline;nitrobenzene?
The IUPAC name of 2-fluoroaniline;nitrobenzene (CID 67592435) is 2-fluoroaniline;nitrobenzene.
What is the SMILES notation for 2-fluoroaniline;nitrobenzene?
The canonical SMILES for 2-fluoroaniline;nitrobenzene is Nc1ccccc1F.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 2-fluoroaniline;nitrobenzene?
The InChIKey is ZEMDOUZMHGKBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FN.C6H5NO2/c7-5-3-1-2-4-6(5)8;8-7(9)6-4-2-1-3-5-6/h1-4H,8H2;1-5H.
What are the key properties of 2-fluoroaniline;nitrobenzene?
2-fluoroaniline;nitrobenzene has a molecular weight of 234.23 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroaniline;nitrobenzene is sourced from PubChem (CID 67592435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).