About 2-amino-6-fluorophenol;hydrochloride
2-amino-6-fluorophenol;hydrochloride (PubChem CID 174428630) has the molecular formula C6H7ClFNO
and a molecular weight of 163.58 g/mol. Its IUPAC name is 2-amino-6-fluorophenol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-6-fluorophenol;hydrochloride |
| PubChem CID | 174428630 |
| Molecular Formula | C6H7ClFNO |
| Molecular Weight | 163.58 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 2-amino-6-fluorophenol;hydrochloride |
| SMILES | Cl.Nc1cccc(F)c1O |
| InChI | InChI=1S/C6H6FNO.ClH/c7-4-2-1-3-5(8)6(4)9;/h1-3,9H,8H2;1H |
| InChIKey | GHJVFERSPGZVQG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-fluorophenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-fluorophenol;hydrochloride?
The IUPAC name of 2-amino-6-fluorophenol;hydrochloride (CID 174428630) is 2-amino-6-fluorophenol;hydrochloride.
What is the SMILES notation for 2-amino-6-fluorophenol;hydrochloride?
The canonical SMILES for 2-amino-6-fluorophenol;hydrochloride is Cl.Nc1cccc(F)c1O.
What is the InChIKey of 2-amino-6-fluorophenol;hydrochloride?
The InChIKey is GHJVFERSPGZVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6FNO.ClH/c7-4-2-1-3-5(8)6(4)9;/h1-3,9H,8H2;1H.
What are the key properties of 2-amino-6-fluorophenol;hydrochloride?
2-amino-6-fluorophenol;hydrochloride has a molecular weight of 163.58 g/mol, XLogP of 1.54, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-fluorophenol;hydrochloride is sourced from PubChem (CID 174428630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).