C11H19NOS — CID 123794128
3-(5-ethylthiophen-2-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 123794128) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 3-(5-ethylthiophen-2-yl)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-ethylthiophen-2-yl)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 123794128 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 3-(5-ethylthiophen-2-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCc1ccc(OCCCN(C)C)s1 |
| InChI | InChI=1S/C11H19NOS/c1-4-10-6-7-11(14-10)13-9-5-8-12(2)3/h6-7H,4-5,8-9H2,1-3H3 |
| InChIKey | DFPOPVJARLDZLV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|