C8H13BrN2OS — CID 135198524
3-[(5-bromo-1,3-thiazol-2-yl)oxy]-N,N-dimethylpropan-1-amine (PubChem CID 135198524) has the molecular formula C8H13BrN2OS and a molecular weight of 265.18 g/mol. Its IUPAC name is 3-[(5-bromo-1,3-thiazol-2-yl)oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(5-bromo-1,3-thiazol-2-yl)oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 135198524 |
| Molecular Formula | C8H13BrN2OS |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 3-[(5-bromo-1,3-thiazol-2-yl)oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ncc(Br)s1 |
| InChI | InChI=1S/C8H13BrN2OS/c1-11(2)4-3-5-12-8-10-6-7(9)13-8/h6H,3-5H2,1-2H3 |
| InChIKey | KFGOALQTLRPWHE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|