C9H15N3O — CID 123632919
N,N-dimethyl-3-pyrimidin-4-yloxypropan-1-amine (PubChem CID 123632919) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N,N-dimethyl-3-pyrimidin-4-yloxypropan-1-amine.
| Compound Name | N,N-dimethyl-3-pyrimidin-4-yloxypropan-1-amine |
|---|---|
| PubChem CID | 123632919 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N,N-dimethyl-3-pyrimidin-4-yloxypropan-1-amine |
| SMILES | CN(C)CCCOc1ccncn1 |
| InChI | InChI=1S/C9H15N3O/c1-12(2)6-3-7-13-9-4-5-10-8-11-9/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | SSZFTTJYUHTZCK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|