C19H24N4OS — CID 141100289
2-[3-(dimethylamino)propoxy]-N-(2-ethylphenyl)-[1,3]thiazolo[5,4-b]pyridin-7-amine (PubChem CID 141100289) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propoxy]-N-(2-ethylphenyl)-[1,3]thiazolo[5,4-b]pyridin-7-amine.
| Compound Name | 2-[3-(dimethylamino)propoxy]-N-(2-ethylphenyl)-[1,3]thiazolo[5,4-b]pyridin-7-amine |
|---|---|
| PubChem CID | 141100289 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-[3-(dimethylamino)propoxy]-N-(2-ethylphenyl)-[1,3]thiazolo[5,4-b]pyridin-7-amine |
| SMILES | CCc1ccccc1Nc1ccnc2sc(OCCCN(C)C)nc12 |
| InChI | InChI=1S/C19H24N4OS/c1-4-14-8-5-6-9-15(14)21-16-10-11-20-18-17(16)22-19(25-18)24-13-7-12-23(2)3/h5-6,8-11H,4,7,12-13H2,1-3H3,(H,20,21) |
| InChIKey | DTESBVOXLGXFGS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|