C16H15N3 — CID 23056755
N-(2-ethylphenyl)quinazolin-2-amine (PubChem CID 23056755) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is N-(2-ethylphenyl)quinazolin-2-amine.
| Compound Name | N-(2-ethylphenyl)quinazolin-2-amine |
|---|---|
| PubChem CID | 23056755 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | N-(2-ethylphenyl)quinazolin-2-amine |
| SMILES | CCc1ccccc1Nc1ncc2ccccc2n1 |
| InChI | InChI=1S/C16H15N3/c1-2-12-7-3-5-9-14(12)18-16-17-11-13-8-4-6-10-15(13)19-16/h3-11H,2H2,1H3,(H,17,18,19) |
| InChIKey | GCDMYOKZTWBHCH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |