C12H14N4 — CID 102985203
3-N-(2-ethylphenyl)pyrazine-2,3-diamine (PubChem CID 102985203) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-N-(2-ethylphenyl)pyrazine-2,3-diamine.
| Compound Name | 3-N-(2-ethylphenyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102985203 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 3-N-(2-ethylphenyl)pyrazine-2,3-diamine |
| SMILES | CCc1ccccc1Nc1nccnc1N |
| InChI | InChI=1S/C12H14N4/c1-2-9-5-3-4-6-10(9)16-12-11(13)14-7-8-15-12/h3-8H,2H2,1H3,(H2,13,14)(H,15,16) |
| InChIKey | OIYXYMGQXWDZSC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |