C14H17BrN2OS — CID 178026029
5-bromo-N-methyl-N-(3-phenylmethoxypropyl)-1,3-thiazol-2-amine (PubChem CID 178026029) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(3-phenylmethoxypropyl)-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-methyl-N-(3-phenylmethoxypropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 178026029 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-bromo-N-methyl-N-(3-phenylmethoxypropyl)-1,3-thiazol-2-amine |
| SMILES | CN(CCCOCc1ccccc1)c1ncc(Br)s1 |
| InChI | InChI=1S/C14H17BrN2OS/c1-17(14-16-10-13(15)19-14)8-5-9-18-11-12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9,11H2,1H3 |
| InChIKey | BKPNHNNGPJPJIC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|