C16H19N5O2 — CID 136539911
6-[methyl(3-phenylmethoxypropyl)amino]-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 136539911) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 6-[methyl(3-phenylmethoxypropyl)amino]-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 6-[methyl(3-phenylmethoxypropyl)amino]-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136539911 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 6-[methyl(3-phenylmethoxypropyl)amino]-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CN(CCCOCc1ccccc1)c1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N5O2/c1-21(8-5-9-23-11-12-6-3-2-4-7-12)16-18-14-13(10-17-20-14)15(22)19-16/h2-4,6-7,10H,5,8-9,11H2,1H3,(H2,17,18,19,20,22) |
| InChIKey | VJQRDCSBMZWYMK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|