About 2,4-dipropoxythiophene
2,4-dipropoxythiophene (PubChem CID 18915152) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is 2,4-dipropoxythiophene.
Molecular Properties
| Compound Name | 2,4-dipropoxythiophene |
| PubChem CID | 18915152 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2,4-dipropoxythiophene |
| SMILES | CCCOc1csc(OCCC)c1 |
| InChI | InChI=1S/C10H16O2S/c1-3-5-11-9-7-10(13-8-9)12-6-4-2/h7-8H,3-6H2,1-2H3 |
| InChIKey | SMVWFEWLOZZPGI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dipropoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dipropoxythiophene?
The IUPAC name of 2,4-dipropoxythiophene (CID 18915152) is 2,4-dipropoxythiophene.
What is the SMILES notation for 2,4-dipropoxythiophene?
The canonical SMILES for 2,4-dipropoxythiophene is CCCOc1csc(OCCC)c1.
What is the InChIKey of 2,4-dipropoxythiophene?
The InChIKey is SMVWFEWLOZZPGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-3-5-11-9-7-10(13-8-9)12-6-4-2/h7-8H,3-6H2,1-2H3.
What are the key properties of 2,4-dipropoxythiophene?
2,4-dipropoxythiophene has a molecular weight of 200.30 g/mol, XLogP of 3.33, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dipropoxythiophene is sourced from PubChem (CID 18915152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).