C15H24LiO3P — CID 141016001
lithium (2,4,6-tripropoxyphenyl)phosphanide (PubChem CID 141016001) has the molecular formula C15H24LiO3P and a molecular weight of 290.27 g/mol. Its IUPAC name is lithium (2,4,6-tripropoxyphenyl)phosphanide.
| Compound Name | lithium (2,4,6-tripropoxyphenyl)phosphanide |
|---|---|
| PubChem CID | 141016001 |
| Molecular Formula | C15H24LiO3P |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | lithium (2,4,6-tripropoxyphenyl)phosphanide |
| SMILES | CCCOc1cc(OCCC)c([PH-])c(OCCC)c1.[Li+] |
| InChI | InChI=1S/C15H24O3P.Li/c1-4-7-16-12-10-13(17-8-5-2)15(19)14(11-12)18-9-6-3;/h10-11,19H,4-9H2,1-3H3;/q-1;+1 |
| InChIKey | KGAWABPEIFKOEG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|