C10H14O2S2Sn — CID 15186090
4,7-dimethoxy-2,2-dimethyl-1,3,2-benzodithiastannole (PubChem CID 15186090) has the molecular formula C10H14O2S2Sn and a molecular weight of 349.07 g/mol. Its IUPAC name is 4,7-dimethoxy-2,2-dimethyl-1,3,2-benzodithiastannole.
| Compound Name | 4,7-dimethoxy-2,2-dimethyl-1,3,2-benzodithiastannole |
|---|---|
| PubChem CID | 15186090 |
| Molecular Formula | C10H14O2S2Sn |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 4,7-dimethoxy-2,2-dimethyl-1,3,2-benzodithiastannole |
| SMILES | COc1ccc(OC)c2c1S[Sn](C)(C)S2 |
| InChI | InChI=1S/C8H10O2S2.2CH3.Sn/c1-9-5-3-4-6(10-2)8(12)7(5)11;;;/h3-4,11-12H,1-2H3;2*1H3;/q;;;+2/p-2 |
| InChIKey | IUSLDJXWLUJVPY-UHFFFAOYSA-L |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |