C16H12O2S8 — CID 10672794
2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,8-dimethoxy-[1,3]dithiolo[4,5-b][1,4]benzodithiine (PubChem CID 10672794) has the molecular formula C16H12O2S8 and a molecular weight of 492.81 g/mol. Its IUPAC name is 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,8-dimethoxy-[1,3]dithiolo[4,5-b][1,4]benzodithiine.
| Compound Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,8-dimethoxy-[1,3]dithiolo[4,5-b][1,4]benzodithiine |
|---|---|
| PubChem CID | 10672794 |
| Molecular Formula | C16H12O2S8 |
| Molecular Weight | 492.81 g/mol |
| Exact Mass | 491.86 |
| IUPAC Name | 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,8-dimethoxy-[1,3]dithiolo[4,5-b][1,4]benzodithiine |
| SMILES | COc1ccc(OC)c2c1SC1=C(SC(=C3SC4=C(SCCS4)S3)S1)S2 |
| InChI | InChI=1S/C16H12O2S8/c1-17-7-3-4-8(18-2)10-9(7)21-13-14(22-10)26-16(25-13)15-23-11-12(24-15)20-6-5-19-11/h3-4H,5-6H2,1-2H3 |
| InChIKey | RVCHRNPSYVTRTJ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.81 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |