C10H12O2S — CID 154301881
8-methoxy-3,4-dihydro-2H-thiochromen-5-ol (PubChem CID 154301881) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 8-methoxy-3,4-dihydro-2H-thiochromen-5-ol.
| Compound Name | 8-methoxy-3,4-dihydro-2H-thiochromen-5-ol |
|---|---|
| PubChem CID | 154301881 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 8-methoxy-3,4-dihydro-2H-thiochromen-5-ol |
| SMILES | COc1ccc(O)c2c1SCCC2 |
| InChI | InChI=1S/C10H12O2S/c1-12-9-5-4-8(11)7-3-2-6-13-10(7)9/h4-5,11H,2-3,6H2,1H3 |
| InChIKey | WSUNFHMKFZQHHI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |