C11H15NOS — CID 84621295
5-methoxy-4,8-dimethyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 84621295) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 5-methoxy-4,8-dimethyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 5-methoxy-4,8-dimethyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84621295 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 5-methoxy-4,8-dimethyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | COc1ccc(C)c2c1N(C)CCS2 |
| InChI | InChI=1S/C11H15NOS/c1-8-4-5-9(13-3)10-11(8)14-7-6-12(10)2/h4-5H,6-7H2,1-3H3 |
| InChIKey | PYOMXIPIFIUTJA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |