C12H13NO3S — CID 84634308
2-(5,8-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid (PubChem CID 84634308) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(5,8-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(5,8-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 84634308 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(5,8-dimethyl-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid |
| SMILES | Cc1ccc(C)c2c1SCCN2C(=O)C(=O)O |
| InChI | InChI=1S/C12H13NO3S/c1-7-3-4-8(2)10-9(7)13(5-6-17-10)11(14)12(15)16/h3-4H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | RSWATMYHVOCZJU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|