C10H8FNO3S — CID 84629970
2-(6-fluoro-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid (PubChem CID 84629970) has the molecular formula C10H8FNO3S and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid.
| Compound Name | 2-(6-fluoro-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 84629970 |
| Molecular Formula | C10H8FNO3S |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(6-fluoro-2,3-dihydro-1,4-benzothiazin-4-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C10H8FNO3S/c11-6-1-2-8-7(5-6)12(3-4-16-8)9(13)10(14)15/h1-2,5H,3-4H2,(H,14,15) |
| InChIKey | WWLRLJWRPCINGD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|