C9H10FNS — CID 84618553
6-fluoro-4-methyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 84618553) has the molecular formula C9H10FNS and a molecular weight of 183.25 g/mol. Its IUPAC name is 6-fluoro-4-methyl-2,3-dihydro-1,4-benzothiazine.
| Compound Name | 6-fluoro-4-methyl-2,3-dihydro-1,4-benzothiazine |
|---|---|
| PubChem CID | 84618553 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-fluoro-4-methyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CN1CCSc2ccc(F)cc21 |
| InChI | InChI=1S/C9H10FNS/c1-11-4-5-12-9-3-2-7(10)6-8(9)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | JSMLFOYJLKTIGW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |