C12H17FN2 — CID 166553115
6-fluoro-4-methyl-1-propan-2-yl-2,3-dihydroquinoxaline (PubChem CID 166553115) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 6-fluoro-4-methyl-1-propan-2-yl-2,3-dihydroquinoxaline.
| Compound Name | 6-fluoro-4-methyl-1-propan-2-yl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 166553115 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 6-fluoro-4-methyl-1-propan-2-yl-2,3-dihydroquinoxaline |
| SMILES | CC(C)N1CCN(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C12H17FN2/c1-9(2)15-7-6-14(3)12-8-10(13)4-5-11(12)15/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | KIFDJRRCKONTOY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |