C13H17FN2O2 — CID 119994278
4-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)butanoic acid (PubChem CID 119994278) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 4-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)butanoic acid.
| Compound Name | 4-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)butanoic acid |
|---|---|
| PubChem CID | 119994278 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 4-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)butanoic acid |
| SMILES | CN1CCN(CCCC(=O)O)c2ccc(F)cc21 |
| InChI | InChI=1S/C13H17FN2O2/c1-15-7-8-16(6-2-3-13(17)18)11-5-4-10(14)9-12(11)15/h4-5,9H,2-3,6-8H2,1H3,(H,17,18) |
| InChIKey | BOVCOXXQHNYPGF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |