C18H20FN3O — CID 120613481
3-(2-aminophenyl)-1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-one (PubChem CID 120613481) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-one.
| Compound Name | 3-(2-aminophenyl)-1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 120613481 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 3-(2-aminophenyl)-1-(6-fluoro-4-methyl-2,3-dihydroquinoxalin-1-yl)propan-1-one |
| SMILES | CN1CCN(C(=O)CCc2ccccc2N)c2ccc(F)cc21 |
| InChI | InChI=1S/C18H20FN3O/c1-21-10-11-22(16-8-7-14(19)12-17(16)21)18(23)9-6-13-4-2-3-5-15(13)20/h2-5,7-8,12H,6,9-11,20H2,1H3 |
| InChIKey | NNSIQGWZVXRFCZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|