C23H29FN4OS — CID 20876365
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 20876365) has the molecular formula C23H29FN4OS and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 20876365 |
| Molecular Formula | C23H29FN4OS |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-methyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | CN1CCSc2ccc(C(=O)NCCCN3CCN(c4ccc(F)cc4)CC3)cc21 |
| InChI | InChI=1S/C23H29FN4OS/c1-26-15-16-30-22-8-3-18(17-21(22)26)23(29)25-9-2-10-27-11-13-28(14-12-27)20-6-4-19(24)5-7-20/h3-8,17H,2,9-16H2,1H3,(H,25,29) |
| InChIKey | MFTMDZGBHBIWFG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|