C25H31FN4O2S — CID 20899604
4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-oxobutanamide (PubChem CID 20899604) has the molecular formula C25H31FN4O2S and a molecular weight of 470.61 g/mol. Its IUPAC name is 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-oxobutanamide.
| Compound Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 20899604 |
| Molecular Formula | C25H31FN4O2S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 4-(2,3-dihydro-1,4-benzothiazin-4-yl)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N1CCSc2ccccc21)NCCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H31FN4O2S/c26-20-6-8-21(9-7-20)29-16-14-28(15-17-29)13-3-12-27-24(31)10-11-25(32)30-18-19-33-23-5-2-1-4-22(23)30/h1-2,4-9H,3,10-19H2,(H,27,31) |
| InChIKey | ULTDTTPAEYGXEG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|