C24H29N3O3S — CID 56567166
1-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]butane-1,4-dione (PubChem CID 56567166) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]butane-1,4-dione.
| Compound Name | 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]butane-1,4-dione |
|---|---|
| PubChem CID | 56567166 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzothiazin-4-yl)-4-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]butane-1,4-dione |
| SMILES | COc1ccc(N2CCCN(C(=O)CCC(=O)N3CCSc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-30-20-9-7-19(8-10-20)25-13-4-14-26(16-15-25)23(28)11-12-24(29)27-17-18-31-22-6-3-2-5-21(22)27/h2-3,5-10H,4,11-18H2,1H3 |
| InChIKey | CFPWBTZOQGEGBW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|