C21H23N3O3S — CID 4692271
4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 4692271) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | 4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4692271 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(N2CCN(C(=O)CN3C(=O)CSc4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-27-17-8-6-16(7-9-17)22-10-12-23(13-11-22)20(25)14-24-18-4-2-3-5-19(18)28-15-21(24)26/h2-9H,10-15H2,1H3 |
| InChIKey | HWIOUNDOFRIAIZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|