C26H32FN5O2 — CID 46349925
N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 46349925) has the molecular formula C26H32FN5O2 and a molecular weight of 465.57 g/mol. Its IUPAC name is N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 46349925 |
| Molecular Formula | C26H32FN5O2 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccc(F)cc2)CC1)c1ccc2c(c1)NC(=O)C1CCCCN21 |
| InChI | InChI=1S/C26H32FN5O2/c27-20-6-8-21(9-7-20)31-16-14-30(15-17-31)12-3-11-28-25(33)19-5-10-23-22(18-19)29-26(34)24-4-1-2-13-32(23)24/h5-10,18,24H,1-4,11-17H2,(H,28,33)(H,29,34) |
| InChIKey | VYQXJCHTGGCHGA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|