C26H39N5O2 — CID 92751387
(6aR)-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 92751387) has the molecular formula C26H39N5O2 and a molecular weight of 453.63 g/mol. Its IUPAC name is (6aR)-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aR)-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 92751387 |
| Molecular Formula | C26H39N5O2 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | (6aR)-N-[3-(4-cyclohexylpiperazin-1-yl)propyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(C2CCCCC2)CC1)c1ccc2c(c1)NC(=O)[C@H]1CCCCN21 |
| InChI | InChI=1S/C26H39N5O2/c32-25(20-10-11-23-22(19-20)28-26(33)24-9-4-5-14-31(23)24)27-12-6-13-29-15-17-30(18-16-29)21-7-2-1-3-8-21/h10-11,19,21,24H,1-9,12-18H2,(H,27,32)(H,28,33)/t24-/m1/s1 |
| InChIKey | ZYCXSLMHZRRRJJ-XMMPIXPASA-N |
| XLogP | 3.07 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|