C20H27N3O2 — CID 46349891
N-cycloheptyl-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 46349891) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-cycloheptyl-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | N-cycloheptyl-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 46349891 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-cycloheptyl-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc2c(c1)NC(=O)C1CCCCN21 |
| InChI | InChI=1S/C20H27N3O2/c24-19(21-15-7-3-1-2-4-8-15)14-10-11-17-16(13-14)22-20(25)18-9-5-6-12-23(17)18/h10-11,13,15,18H,1-9,12H2,(H,21,24)(H,22,25) |
| InChIKey | WRQROPTZJDWDEC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |