C20H20FN3O2 — CID 92726258
(6aS)-N-[(4-fluorophenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 92726258) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is (6aS)-N-[(4-fluorophenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aS)-N-[(4-fluorophenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 92726258 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (6aS)-N-[(4-fluorophenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc2c(c1)NC(=O)[C@@H]1CCCCN21 |
| InChI | InChI=1S/C20H20FN3O2/c21-15-7-4-13(5-8-15)12-22-19(25)14-6-9-17-16(11-14)23-20(26)18-3-1-2-10-24(17)18/h4-9,11,18H,1-3,10,12H2,(H,22,25)(H,23,26)/t18-/m0/s1 |
| InChIKey | IOTCXZCEKCNTEQ-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |