C22H25N3O3 — CID 92751386
(6aS)-N-[(4-ethoxyphenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 92751386) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is (6aS)-N-[(4-ethoxyphenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide.
| Compound Name | (6aS)-N-[(4-ethoxyphenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
|---|---|
| PubChem CID | 92751386 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (6aS)-N-[(4-ethoxyphenyl)methyl]-6-oxo-5,6a,7,8,9,10-hexahydropyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc3c(c2)NC(=O)[C@@H]2CCCCN32)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-2-28-17-9-6-15(7-10-17)14-23-21(26)16-8-11-19-18(13-16)24-22(27)20-5-3-4-12-25(19)20/h6-11,13,20H,2-5,12,14H2,1H3,(H,23,26)(H,24,27)/t20-/m0/s1 |
| InChIKey | OKPMGMCUFWWVCP-FQEVSTJZSA-N |
| XLogP | 3.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |