C23H28ClFN4O2 — CID 34989376
4-chloro-N-[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide (PubChem CID 34989376) has the molecular formula C23H28ClFN4O2 and a molecular weight of 446.95 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 34989376 |
| Molecular Formula | C23H28ClFN4O2 |
| Molecular Weight | 446.95 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 4-chloro-N-[4-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCCN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H28ClFN4O2/c24-19-5-3-18(4-6-19)23(31)27-11-1-2-22(30)26-12-13-28-14-16-29(17-15-28)21-9-7-20(25)8-10-21/h3-10H,1-2,11-17H2,(H,26,30)(H,27,31) |
| InChIKey | FQAURSDSIPFWNK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.95 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|