C23H33ClN4O3 — CID 86944721
4-chloro-N-[4-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide (PubChem CID 86944721) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 86944721 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-chloro-N-[4-[2-[4-(cyclopentanecarbonyl)piperazin-1-yl]ethylamino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCCN1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H33ClN4O3/c24-20-9-7-18(8-10-20)22(30)26-11-3-6-21(29)25-12-13-27-14-16-28(17-15-27)23(31)19-4-1-2-5-19/h7-10,19H,1-6,11-17H2,(H,25,29)(H,26,30) |
| InChIKey | PZIYHQFRNXXSER-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|