C11H8FNO4 — CID 96594062
2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid (PubChem CID 96594062) has the molecular formula C11H8FNO4 and a molecular weight of 237.19 g/mol. Its IUPAC name is 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid.
| Compound Name | 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 96594062 |
| Molecular Formula | C11H8FNO4 |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)N1CCC(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C11H8FNO4/c12-6-1-2-8-7(5-6)9(14)3-4-13(8)10(15)11(16)17/h1-2,5H,3-4H2,(H,16,17) |
| InChIKey | DGXLZAWSZWLNIS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|