2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid

C11H8FNO4 — CID 96594062

IUPAC2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)N1CCC(=O)c2cc(F)ccc21
InChIInChI=1S/C11H8FNO4/c12-6-1-2-8-7(5-6)9(14)3-4-13(8)10(15)11(16)17/h1-2,5H,3-4H2,(H,16,17)
InChIKeyDGXLZAWSZWLNIS-UHFFFAOYSA-N
MW237.19 g/mol
LogP0.83
Rot. Bonds

About 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid

2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid (PubChem CID 96594062) has the molecular formula C11H8FNO4 and a molecular weight of 237.19 g/mol. Its IUPAC name is 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid.

Molecular Properties

Compound Name2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid
PubChem CID96594062
Molecular FormulaC11H8FNO4
Molecular Weight237.19 g/mol
Exact Mass237.04
IUPAC Name2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid
SMILESO=C(O)C(=O)N1CCC(=O)c2cc(F)ccc21
InChIInChI=1S/C11H8FNO4/c12-6-1-2-8-7(5-6)9(14)3-4-13(8)10(15)11(16)17/h1-2,5H,3-4H2,(H,16,17)
InChIKeyDGXLZAWSZWLNIS-UHFFFAOYSA-N
XLogP0.83
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.19
LogP ≤ 50.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid?
The IUPAC name of 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid (CID 96594062) is 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid.
What is the SMILES notation for 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid?
The canonical SMILES for 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid is O=C(O)C(=O)N1CCC(=O)c2cc(F)ccc21.
What is the InChIKey of 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid?
The InChIKey is DGXLZAWSZWLNIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO4/c12-6-1-2-8-7(5-6)9(14)3-4-13(8)10(15)11(16)17/h1-2,5H,3-4H2,(H,16,17).
What are the key properties of 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid?
2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid has a molecular weight of 237.19 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-4-oxo-2,3-dihydroquinolin-1-yl)-2-oxoacetic acid is sourced from PubChem (CID 96594062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).