C15H16FNO2 — CID 110635059
1-(cyclopentanecarbonyl)-6-fluoro-2,3-dihydroquinolin-4-one (PubChem CID 110635059) has the molecular formula C15H16FNO2 and a molecular weight of 261.30 g/mol. Its IUPAC name is 1-(cyclopentanecarbonyl)-6-fluoro-2,3-dihydroquinolin-4-one.
| Compound Name | 1-(cyclopentanecarbonyl)-6-fluoro-2,3-dihydroquinolin-4-one |
|---|---|
| PubChem CID | 110635059 |
| Molecular Formula | C15H16FNO2 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 1-(cyclopentanecarbonyl)-6-fluoro-2,3-dihydroquinolin-4-one |
| SMILES | O=C1CCN(C(=O)C2CCCC2)c2ccc(F)cc21 |
| InChI | InChI=1S/C15H16FNO2/c16-11-5-6-13-12(9-11)14(18)7-8-17(13)15(19)10-3-1-2-4-10/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | NQADHLIQZLUUNI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |