C14H12FN3OS — CID 104638050
(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-fluoro-2-pyridinyl)methanone (PubChem CID 104638050) has the molecular formula C14H12FN3OS and a molecular weight of 289.34 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 104638050 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-fluoro-2-pyridinyl)methanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1ccc(F)cn1)CCS2 |
| InChI | InChI=1S/C14H12FN3OS/c15-9-1-3-11(17-8-9)14(19)18-5-6-20-13-4-2-10(16)7-12(13)18/h1-4,7-8H,5-6,16H2 |
| InChIKey | OBXMAEDMCSZSHL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|