C13H11BrN2OS2 — CID 107959412
(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-bromothiophen-3-yl)methanone (PubChem CID 107959412) has the molecular formula C13H11BrN2OS2 and a molecular weight of 355.28 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-bromothiophen-3-yl)methanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-bromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107959412 |
| Molecular Formula | C13H11BrN2OS2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-(5-bromothiophen-3-yl)methanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1csc(Br)c1)CCS2 |
| InChI | InChI=1S/C13H11BrN2OS2/c14-12-5-8(7-19-12)13(17)16-3-4-18-11-2-1-9(15)6-10(11)16/h1-2,5-7H,3-4,15H2 |
| InChIKey | RTBQHBKOBARGMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|