C13H12N4OS — CID 104669192
(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-pyridazin-4-ylmethanone (PubChem CID 104669192) has the molecular formula C13H12N4OS and a molecular weight of 272.33 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-pyridazin-4-ylmethanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 104669192 |
| Molecular Formula | C13H12N4OS |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-pyridazin-4-ylmethanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1ccnnc1)CCS2 |
| InChI | InChI=1S/C13H12N4OS/c14-10-1-2-12-11(7-10)17(5-6-19-12)13(18)9-3-4-15-16-8-9/h1-4,7-8H,5-6,14H2 |
| InChIKey | BCIUMWALIQXEKP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|