C12H13NO2S — CID 62025083
3-[2-(2-methylphenyl)-2-oxoethyl]-1,3-thiazolidin-2-one (PubChem CID 62025083) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 3-[2-(2-methylphenyl)-2-oxoethyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[2-(2-methylphenyl)-2-oxoethyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 62025083 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-[2-(2-methylphenyl)-2-oxoethyl]-1,3-thiazolidin-2-one |
| SMILES | Cc1ccccc1C(=O)CN1CCSC1=O |
| InChI | InChI=1S/C12H13NO2S/c1-9-4-2-3-5-10(9)11(14)8-13-6-7-16-12(13)15/h2-5H,6-8H2,1H3 |
| InChIKey | MJGZENABCHHYHN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|