C14H19NOS — CID 62030884
1-(2-methylphenyl)-2-(1,4-thiazepan-4-yl)ethanone (PubChem CID 62030884) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(2-methylphenyl)-2-(1,4-thiazepan-4-yl)ethanone.
| Compound Name | 1-(2-methylphenyl)-2-(1,4-thiazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 62030884 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(2-methylphenyl)-2-(1,4-thiazepan-4-yl)ethanone |
| SMILES | Cc1ccccc1C(=O)CN1CCCSCC1 |
| InChI | InChI=1S/C14H19NOS/c1-12-5-2-3-6-13(12)14(16)11-15-7-4-9-17-10-8-15/h2-3,5-6H,4,7-11H2,1H3 |
| InChIKey | FIXRXGOIBMONSD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |