C11H16N2O — CID 23008911
8-methoxy-1-methyl-3,4-dihydro-2H-quinolin-4-amine (PubChem CID 23008911) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 8-methoxy-1-methyl-3,4-dihydro-2H-quinolin-4-amine.
| Compound Name | 8-methoxy-1-methyl-3,4-dihydro-2H-quinolin-4-amine |
|---|---|
| PubChem CID | 23008911 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 8-methoxy-1-methyl-3,4-dihydro-2H-quinolin-4-amine |
| SMILES | COc1cccc2c1N(C)CCC2N |
| InChI | InChI=1S/C11H16N2O/c1-13-7-6-9(12)8-4-3-5-10(14-2)11(8)13/h3-5,9H,6-7,12H2,1-2H3 |
| InChIKey | YHBGDNUGFLACLY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |