C11H16N2O — CID 83860757
(7-methoxy-1-methyl-2,3-dihydroindol-2-yl)methanamine (PubChem CID 83860757) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (7-methoxy-1-methyl-2,3-dihydroindol-2-yl)methanamine.
| Compound Name | (7-methoxy-1-methyl-2,3-dihydroindol-2-yl)methanamine |
|---|---|
| PubChem CID | 83860757 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (7-methoxy-1-methyl-2,3-dihydroindol-2-yl)methanamine |
| SMILES | COc1cccc2c1N(C)C(CN)C2 |
| InChI | InChI=1S/C11H16N2O/c1-13-9(7-12)6-8-4-3-5-10(14-2)11(8)13/h3-5,9H,6-7,12H2,1-2H3 |
| InChIKey | BHDRANQCYPVPIB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |