C12H18N2O — CID 84620814
3-ethyl-5-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline (PubChem CID 84620814) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3-ethyl-5-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 3-ethyl-5-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 84620814 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3-ethyl-5-methoxy-4-methyl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCC1CNc2cccc(OC)c2N1C |
| InChI | InChI=1S/C12H18N2O/c1-4-9-8-13-10-6-5-7-11(15-3)12(10)14(9)2/h5-7,9,13H,4,8H2,1-3H3 |
| InChIKey | SKVWIAIXRHUKMP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |