C12H18N2O — CID 117199162
(1-ethyl-4-methoxy-2,3-dihydroindol-2-yl)methanamine (PubChem CID 117199162) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (1-ethyl-4-methoxy-2,3-dihydroindol-2-yl)methanamine.
| Compound Name | (1-ethyl-4-methoxy-2,3-dihydroindol-2-yl)methanamine |
|---|---|
| PubChem CID | 117199162 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (1-ethyl-4-methoxy-2,3-dihydroindol-2-yl)methanamine |
| SMILES | CCN1c2cccc(OC)c2CC1CN |
| InChI | InChI=1S/C12H18N2O/c1-3-14-9(8-13)7-10-11(14)5-4-6-12(10)15-2/h4-6,9H,3,7-8,13H2,1-2H3 |
| InChIKey | IWHVUCVFSHRTIV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |