C12H17FN2 — CID 117198805
2-(1-ethyl-4-fluoro-2,3-dihydroindol-2-yl)ethanamine (PubChem CID 117198805) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-(1-ethyl-4-fluoro-2,3-dihydroindol-2-yl)ethanamine.
| Compound Name | 2-(1-ethyl-4-fluoro-2,3-dihydroindol-2-yl)ethanamine |
|---|---|
| PubChem CID | 117198805 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-(1-ethyl-4-fluoro-2,3-dihydroindol-2-yl)ethanamine |
| SMILES | CCN1c2cccc(F)c2CC1CCN |
| InChI | InChI=1S/C12H17FN2/c1-2-15-9(6-7-14)8-10-11(13)4-3-5-12(10)15/h3-5,9H,2,6-8,14H2,1H3 |
| InChIKey | SUIHYGFOIHFGTD-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |