C13H19FN2 — CID 117201218
3-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propan-1-amine (PubChem CID 117201218) has the molecular formula C13H19FN2 and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propan-1-amine.
| Compound Name | 3-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 117201218 |
| Molecular Formula | C13H19FN2 |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-(1-ethyl-5-fluoro-2,3-dihydroindol-2-yl)propan-1-amine |
| SMILES | CCN1c2ccc(F)cc2CC1CCCN |
| InChI | InChI=1S/C13H19FN2/c1-2-16-12(4-3-7-15)9-10-8-11(14)5-6-13(10)16/h5-6,8,12H,2-4,7,9,15H2,1H3 |
| InChIKey | JSQCIFRBINVKLO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |