C11H15ClN2 — CID 83868700
2-(5-chloro-1-methyl-2,3-dihydroindol-2-yl)ethanamine (PubChem CID 83868700) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 2-(5-chloro-1-methyl-2,3-dihydroindol-2-yl)ethanamine.
| Compound Name | 2-(5-chloro-1-methyl-2,3-dihydroindol-2-yl)ethanamine |
|---|---|
| PubChem CID | 83868700 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(5-chloro-1-methyl-2,3-dihydroindol-2-yl)ethanamine |
| SMILES | CN1c2ccc(Cl)cc2CC1CCN |
| InChI | InChI=1S/C11H15ClN2/c1-14-10(4-5-13)7-8-6-9(12)2-3-11(8)14/h2-3,6,10H,4-5,7,13H2,1H3 |
| InChIKey | JDQPCLRRBDCYTJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |