C12H18N2 — CID 84618930
2-(1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine (PubChem CID 84618930) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-(1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine.
| Compound Name | 2-(1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine |
|---|---|
| PubChem CID | 84618930 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-(1-methyl-3,4-dihydro-2H-quinolin-2-yl)ethanamine |
| SMILES | CN1c2ccccc2CCC1CCN |
| InChI | InChI=1S/C12H18N2/c1-14-11(8-9-13)7-6-10-4-2-3-5-12(10)14/h2-5,11H,6-9,13H2,1H3 |
| InChIKey | LLUOVFKSHIKMMD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |