C13H21N3 — CID 84623417
2-(1,4,7-trimethyl-2,3-dihydroquinoxalin-2-yl)ethanamine (PubChem CID 84623417) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-(1,4,7-trimethyl-2,3-dihydroquinoxalin-2-yl)ethanamine.
| Compound Name | 2-(1,4,7-trimethyl-2,3-dihydroquinoxalin-2-yl)ethanamine |
|---|---|
| PubChem CID | 84623417 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 2-(1,4,7-trimethyl-2,3-dihydroquinoxalin-2-yl)ethanamine |
| SMILES | Cc1ccc2c(c1)N(C)C(CCN)CN2C |
| InChI | InChI=1S/C13H21N3/c1-10-4-5-12-13(8-10)16(3)11(6-7-14)9-15(12)2/h4-5,8,11H,6-7,9,14H2,1-3H3 |
| InChIKey | AMOONRVBKCJWKD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |